- Icilin
chembox new
ImageFile = Icilin.svg
ImageSize = 250px
IUPACName = 1-(2-hydroxyphenyl)-4-(3-nitrophenyl)-3,6-dihydropyrimidin-2-one
SystematicName =
OtherNames = AG-3-5
Section1 = Chembox Identifiers
Abbreviations =
CASNo = 36945-98-9
EINECS =
EINECSCASNO =
PubChem = 161930
SMILES = C1C=C(NC(=O)N1C2=CC=CC=C2O)C3=CC(=CC=C3) [N+] (=O) [O-]
InChI = InChI=1/C16H13N3O4/c20-15-7-2-1-6-14(15)18-9-8-13(17-16(18)21)11-4-3-5-12(10-11)19(22)23/h1-8,10,20H,9H2,(H,17,21)/f/h17H
RTECS =
MeSHName =
ChEBI =
KEGG =
ATCCode_prefix =
ATCCode_suffix =
ATC_Supplemental =
Section2 = Chembox Properties
Formula = C16H13N3O4
MolarMass = 311.29 g/mol
Appearance =
Density =
MeltingPt =
Melting_notes =
BoilingPt =
Boiling_notes =
Solubility =
SolubleOther =
Solvent =
LogP =
VaporPressure =
HenryConstant =
AtmosphericOHRateConstant =
pKa =
pKb =
Section3 = Chembox Structure
CrystalStruct =
Coordination =
MolShape =
Section4 = Chembox Thermochemistry
DeltaHf =
DeltaHc =
Entropy =
HeatCapacity =
Section5 = Chembox Pharmacology
AdminRoutes =
Bioavail =
Metabolism =
HalfLife =
ProteinBound =
Excretion =
Legal_status =
Legal_US =
Legal_UK =
Legal_AU =
Legal_CA =
PregCat =
PregCat_AU =
PregCat_US =
Section6 = Chembox Explosive
ShockSens =
FrictionSens =
ExplosiveV =
REFactor =
Section7 = Chembox Hazards
ExternalMSDS =
EUClass =
EUIndex =
MainHazards =
NFPA-H =
NFPA-F =
NFPA-R =
NFPA-O =
RPhrases =
SPhrases =
RSPhrases =
FlashPt =
Autoignition =
ExploLimits =
LD50 =
PEL =
Section8 = Chembox Related
OtherAnions =
OtherCations =
OtherFunctn =
Function =
OtherCpds =Icilin is a
synthetic super-agonist of the transient receptor potential M8 (TRPM8 )ion channel . Although structurally not related withmenthol it produces an extreme sensation of cold both in humans and animals. It is almost 200 times more potent than menthol and 2.5 times more efficacious.cite journal |author=Wei ET, Seid DA |title=AG-3-5: a chemical producing sensations of cold |journal=J. Pharm. Pharmacol. |volume=35 |issue=2 |pages=110–2 |year=1983 |pmid=6131976 |doi=] Despite their similar effects icilin activates the TRPM8 receptor in a different way.cite journal |author=Andersson DA, Chase HW, Bevan S |title=TRPM8 activation by menthol, icilin, and cold is differentially modulated by intracellular pH |journal=J. Neurosci. |volume=24 |issue=23 |pages=5364–9 |year=2004 |pmid=15190109 |doi=10.1523/JNEUROSCI.0890-04.2004] It is now used as a research tool for the study of TRP channels.References
External links
[http://www.caymanchem.com/app/template/Product.vm/catalog/10137/a/z Product sheet of Icilin from Cayman Chemical]
Wikimedia Foundation. 2010.