Blattellaquinone

Chembox new
Name = Blattellaquinone
ImageFile = Gentisyl quinone isovalerate.png ImageSize = 200px
ImageName = Benzene
IUPACName = (3,6-Dioxocyclohexa-1,4-dienyl)methyl 3-methylbutanoate
OtherNames = Blattellaquinone, gentisyl quinone isovalerate
Section1 = Chembox Identifiers
SMILES = O=C(C=C1)C(COC(CC(C)C)=O)=CC1=O
CASNo = 849762-24-9
RTECS =
Section2 = Chembox Properties
Formula = C₁₂H₁₄O₄
MolarMass = 222.24 g/mol
Appearance =
Density =
Solubility =
MeltingPt =
BoilingPt =
Section8 = Chembox Related
OtherCpds =

Blattellaquinone, also known as gentisyl quinone isovalerate, is a sex pheromone of the German cockroach ("Blattella germanica"). Blattellaquinone is secreted by females to attract male cockroaches. cite journal
author = Nojima S, Schal C, Webster FX, Santangelo RG, Roelofs WL
year = 2005
title = Identification of the sex pheromone of the German cockroach, "Blattella germanica"
journal = Science
volume = 307
issue = 5712
pages = 1029–1031
location =
pmid = 15718472
doi = 10.1126/science.1107163
url =]

External links

* [http://pubs.acs.org/cen/news/83/i08/8308notw1.html Trapping roaches with biochemistry]

References