Hexachlorophenol

Chembox new
Name = Hexachlorophenol
ImageFile = Hexachlorophenol.svg
ImageSize = 120px
ImageName = Chemical structure of hexachlorophenol
IUPACName = 2,5-Cyclohexadien-1-one, 2,3,4,4,5,6-hexachloro-
Section1 = Chembox Identifiers
CASNo = 599-52-0
SMILES = O=C1C(=C(Cl)C(Cl)(Cl)C(=C1Cl)Cl)Cl
RTECS = SN1575000
Section2 = Chembox Properties
Formula = C₆Cl₆O
MolarMass = 300.782 g/mol
Density =
MeltingPt = 113 °C
BoilingPt =
Section7 = Chembox Hazards
RPhrases = R22,R36,R38,R40,R50,R53
SPhrases = S2,S36,S37,S60,S61

Hexachlorophenol (HCP) is an organochloride of phenol. It is normally produced by electrophilic chlorination of phenol by chlorine gas in the presence of metal chloride catalyst, such as ferric chloride, which acts as a Lewis acid. It can also be produced by alkaline hydrolysis of chlorobenzenes at high temperature and pressure, by conversion of diazonium salts of chlorinated anilines, or by chlorination of phenolsulphonic acids and benzenesulphonic acids followed by removal of the sulphonic acid group.

References

ee also

* Pentachlorophenol
* Hexachlorobenzene