Carpacin

Chembox new
ImageFile = carpacin.png ImageSize = 200px
IUPACName = (E)-2-Methoxy-4,5-methylenedioxypropenylbenzene
OtherNames =
Section1 = Chembox Identifiers
CASNo = 194605-01-1
PubChem =
SMILES = C/C=C/C1=CC(OCO2)=C2C=C1OC
Section2 = Chembox Properties
C=11|H=12|O=3
MolarMass = 192.21
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

Carpacin is a naturally occurring organic compound first isolated from the Carpano tree ("Cinnamomum sp."), from which it derives its name. [cite journal|title=Trans-2-methoxy-4,5-methylenedioxypropenylbenzene (carpacin) from a "Cinnamomum sp." from Bougainville|author=J. Mohandas, M. Slaytor, T.R. Watson|journal=Aust. J. Chem.|year=1969|volume=22|pages=1803–1804] Carpacin is classified as a phenylpropanoid.

Carpacin has been prepared synthetically from sesamolcite journal|journal=Journal of the Chinese Chemical Society|year=2000|volume=47|pages=1165–1169|title=Total Synthesis of Carpacin and Its Geometric Isomeras a Cancer Chemopreventer|author=Tsui-Hwa Tseng, Yen-Min Tsheng, Yean-Jang Lee, Hsing-Ling Hsu] and has been studied for potential use as an insecticide, [cite journal|author=BH Alexander, SI Gertler, RT Brown, TA Oda, M Beroza|journal=J. Org. Chem.|year=1959|volume=24|pages=1504|title=|doi=10.1021/jo01092a029 ] an antidepressant, and an inhibitor of carcinogenesis.

References