4-HO-DET

drugbox
IUPAC_name = 3-(2-diethylaminoethyl)-1H-indol-4-ol

---

---

width = 140
CAS_number = 22204-89-3
ATC_prefix =
ATC_suffix =
PubChem =
C=14 | H=20 | N=2 | O=1
molecular_weight = 232.32 g/mol
smiles = CCN(CC)CCC1=CNC2=C1C(O)=CC=C2
melting_point =
melting_high =
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category =
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

4-HO-DET, also known as 4-hydroxy-diethyl-tryptamine, CZ-74, or ethocin, is a hallucinogenic drug and psychedelic compound of moderate duration. 4-HO-DET is a substituted tryptamine, structurally related to psilocin and 4-HO-DIPT.

Analogs

The acetic acid ester of 4-HO-DET is known as 4-AcO-DET or ethacetin. The phosphoric acid ester of 4-HO-DET is known as 4-phosphoryloxy-DET, CEY-19, or ethocybin.

History

4-HO-DET received the lab code CZ-74 in the late 1950s by the inventors of the substance, Albert Hofmann and Franz Troxler. The substance was used together with its phosporyloxy-analog CEY-19 in human clinical trials in the 1960s by the German researchers Hanscarl Leuner and G. Baer.

Dosage

10-25mg is the usual oral dosage for 4-HO-DET, while the acetate and phosphate esters are said to require a slightly higher dosage.

Effects

Ethocin produces entheogenic effects similar to LSD and psilocybin. Some users have reported unpleasant anxiety and stimulation with this drug, while other accounts label the experience as being much milder than LSD or psilocybin.

ee also

* TiHKAL
* Indoles

External links

* [http://www.erowid.org/library/books_online/tihkal/tihkal16.shtml TiHKAL 4-HO-DET] information at Erowid
* [http://www.erowid.org/chemicals/4_acetoxy_det/4_acetoxy_det_article1.shtml Ethacetin degradation] by Murple