TCEP

Chembox new
ImageFile = TCEP.png ImageSize = 200px
IUPACName = tris(2-carboxyethyl)phosphine
OtherNames = TCEP
Section1 = Chembox Identifiers
CASNo = 51805-45-9
PubChem =
SMILES = OC(CCP(CCC(O)=O)CCC(O)=O)=O
Section2 = Chembox Properties
Formula = C₉H₁₅O₆P
MolarMass = 250.19 g mol⁻¹
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

TCEP ("tris"(2-carboxyethyl)phosphine) is a reducing agent frequently used in biochemistry and molecular biology applications [ cite journal | author = Ruegg, U.T and Rudinger, J. | year = 1977 | title = Reductive cleavage of cystine disulfides with tributylphosphine | journals = Methods Enzymol. | volume = 47 | pages = 111-126 | doi = 10.1016/0076-6879(77)47012-5 ] . It is often prepared and used as a hydrochloride salt. TCEP is also available as a stabilized solution at neutral pH and immobilized onto an agarose support to facilitate removal of the reducing agent.

Applications

TCEP is often used as a reducing agent to break disulfide bonds within and between proteins as a preparatory step for gel electrophoresis.

Compared to the other two most common agents used for this purpose (dithiothreitol and β-mercaptoethanol), TCEP has the advantage of being odourless, more powerful reductant, irreversible reductant, more hydrophilic and is more resistant to oxidation in air. TCEP also does not reduce metals used in immobilized metal affinity chromatography.

External links

* [http://www.piercenet.com/Products/Browse.cfm?fldID=02051012&WT.mc_id=wiki_TCEP_brj More information and reaction schemes]

References