3C-BZ

Chembox new
ImageFile1 = 3C-BZ.png ImageSize1 = 180px
ImageFile2 = 3C-BZ-3d-sticks.png ImageSize2 = 200px
IUPACName = 4-Benzyloxy-3,5-methoxy-alpha-methyl-1-ethane
OtherNames = 4-Benzyloxy-3,5-methoxy-amphetamine
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = C1=C(C(=C(C=C1CC(C)N)OC)OCC2=CC=CC=C2)OC
Section2 = Chembox Properties
Formula = C₁₈H₂₃NO₃
MolarMass = 301.39 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

3C-BZ, or 3,5-methyloxy-amphetamine, is a lesser-known psychedelic drug and a substituted amphetamine. 3C-BZ was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the dosage range is listed as 25-200 mg, and the duration as 18-24 hours. According to anecdotal reports from the substance's entry in PiHKAL, MDPH's effects can vary significantly, ranging from intensified emotions and strange dreams, to effects similar to those of LSD or TMA [CitePiHKAL] . Very little data exists about the pharmacological properties, metabolism, and toxicity of MDPH.

References

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal021.shtml 3C-BZ Entry in "PiHKAL"]