Acibenzolar-S-methyl

Chembox new
Reference = [http://www.epa.gov/opprd001/factsheets/acibenzolar.pdf EPA Fact Sheet] ]
ImageFile = acibenzolar-S-methyl .png ImageSize = 180px
IUPACName ="S"-Methyl 1,2,3-benzothiadiazole-7-carbothioate
OtherNames =
Section1 = Chembox Identifiers
CASNo = 135158-54-2
PubChem = 86412
SMILES = CSC(=O)C1=C2C(=CC=C1)N=NS2
Section2 = Chembox Properties
Formula = C₈H₆N₂OS₂
MolarMass = 210.28 g/mol
Appearance = Beige fine powder
Density =
MeltingPt = 132.9 °C
BoilingPt =
Solubility = 7.7 mg/L
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition = Acibenzolar-S-methyl is a fungicide that works by activating a plant's own defense system by increasing the transcription of W-box controlled genes such as CAD1, NPR1 and PR2. It is a methyl derivative of acibenzolar.

References

External links

* [http://www.pesticideinfo.org/Detail_Chemical.jsp?Rec_Id=PC36214 More Info about toxicity etc.]