- 3-Methylheptane
Chembox new
ImageFile = 3-Methylheptane.png
ImageSize = 160px
ImageFile1 = Dl-3-methyl-heptane-spaceFill.png
IUPACName = 3-Methylheptane
OtherNames = 2-Ethylhexane
Section1 = Chembox Identifiers
CASNo = 589-81-1
EINECS = 209-660-6
PubChem = 86182
SMILES = CCCCC(C)CC
InChI = 1/C8H18/c1-4-6-7-8(3)5-2/h8H,4-7H2,1-3H3
Section2 = Chembox Properties
Formula = C8H18
MolarMass = 114.23 g.mol-1
Appearance = Clear liquid
Density = 0.705 g.cm-3
MeltingPtC = -121
BoilingPtC = +119
Solubility =
HenryLaw = 0.00027 mol.kg-1.bar-1
Section3 = Chembox Hazards
MainHazards = Harmful (Xn), Highly flammable (F+), Dangerous for the environment (N)
RPhrases = R11, R38, R50/53, R65, R67
SPhrases = S9, S16, S29, S33, S60, S61, S62
FlashPt = 7.2 °C
Autoignition =3-Methylheptane is a branched
alkane isomer ic tooctane . Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3. It has one stereocenter.Its
refractive index is 1.398 (20 °C, D).External links
* [http://www.springerlink.com/content/qx16v65540365nx4/ Non-stereospecific oxidation of DL-3-methylheptane by aPseudomonas]
* [http://www.cheric.org/kdb/kdb/hcprop/showprop.php?cmpid=48 Physical and chemical properties table]
Wikimedia Foundation. 2010.