Juglone

Chembox new
Name = Juglone
ImageFile = Juglone.png ImageSize = 120px
ImageName = Juglone
IUPACName = 5-hydroxy-1,4-naphthalenedione
OtherNames = 5-hydroxy-1,4-naphthoquinone

5-hydroxy-"p"-naphthoquinonejuglone
regianin
Section1 = Chembox Identifiers
SMILES = CC2=CC(C1=C(O)C=CC=C1C2=O)=O
CASNo = 481-39-0
RTECS = QJ5775000
Section2 = Chembox Properties
Formula = C₁₀H₆ O₃
MolarMass = 174.15 g/mol
Appearance = yellow solid
Density =
Solubility = slightly sol.
MeltingPt = 155 °C
BoilingPt =
pKa =
pKb =
Section7 = Chembox Hazards
ExternalMSDS =
MainHazards =
FlashPt =
RPhrases = R25
SPhrases = S28A S45
Section8 = Chembox Related
OtherCpds = quinone

Juglone is an aromatic organic compound with the molecular formula C₁₀H₆O₃. It occurs naturally in the leaves, roots and bark of plants in the Juglandaceae family, particularly the black walnut. Juglone is an allelopathic compound, meaning it is synthesized by one type of plant and affects the growth of another. In the case of juglone, it is toxic or growth-stunting to many types of plants. Landscapers have long known that gardening underneath or near black walnut trees can be difficult. Juglone exerts its effect by inhibiting certain enzymes needed for metabolic function. It is occasionally used as a herbicide. A number of plants and trees are resistant to juglone including some Acer, Betula, Fagus and others

Because of its tendency to create dark orange-brown stains, juglone has also found use as a coloring agent for foods and cosmetics, such as hair dyes. It is known in the food industry as C.I. Natural Brown 7 or C.I. 75500. Traditionally, juglone has been used as a natural dye for clothing and fabrics, particularly wool, and as ink. Its other names are Iuglon, Juglane, Nucin, Regianin, Walnut extract, Yuglon, NCI 2323 and Oil Red BS. It is an isomer of lawsone.

References

* [http://www.wvu.edu/~agexten/hortcult/fruits/blkwalnt.htm Juglone toxicity]
* [http://blog.ashridgetrees.co.uk/death-by-black-walnut/ Death by Black Walnut]

External links

(on Wikibooks)