- Lufenuron
chembox new
ImageFile = Lufenuron.png
ImageSize =
IUPACName = 1- [2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl] -3-(2,6-difluorobenzoyl)urea
OtherNames = "N"- [ [ [2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl] amino] carbonyl] -2,6-difluorobenzamide
Fluphenacur
U.S. EPA PC Code: 118205
Section1 = Chembox Identifiers
Abbreviations =
CASNo = 103055-07-8
EINECS =
PubChem =
SMILES = O=C(NC(C2=C(F)C=CC=C2F)=O)NC1=CC(Cl)=C(OC(F)(F)C(C(F)(F)F)F)C=C1Cl
InChI =
RTECS =
MeSHName =
ChEBI =
KEGG =
ATCCode_prefix =
ATCCode_suffix =
ATC_Supplemental =
Section2 = Chembox Properties
Formula = C17H8Cl2F8N2O3
MolarMass = 511.15 g/mol
Appearance =
Density =
MeltingPtC = 174
Melting_notes =
BoilingPt =
Boiling_notes =
Solubility =
SolubleOther =
Solvent =
pKa =
pKb =
Section7 = Chembox Hazards
EUClass =
EUIndex =
MainHazards =
NFPA-H =
NFPA-F =
NFPA-R =
NFPA-O =
RPhrases =
SPhrases =
RSPhrases =
FlashPt =
Autoignition =
ExploLimits =
PEL =Lufenuron is the
active ingredient in the veterinaryflea control medication, "Program", and the veterinary coformulation flea control,heartworm prevention, andanthelmintic medicine, "Sentinel Flavor Tabs".Lufenuron is stored in the animal's body
fat and transferred to adult fleas through theirbite . Adult fleas transfer it to their eggs by its presence in the mother flea's blood, or by the larva feeding on pre-digestedblood .Lufenuron, a
benzoylurea pesticide, inhibits the production ofchitin inlarva l fleas. Without chitin, a larval flea will never develop anexoskeleton . Attacking the ability to create chitin may make lufenuron an effective remedy against fungal infections, such asringworm (adermatophyte infection and not a worm at all).It has no known
toxic effects at any dosage onhuman s or other animals in the environment that do not depend onchitin , though the orally-administered pills can sometimes cause an upset stomach withacid reflux .Lufenuron is also sold as a crop protection product (pesticide) by Syngenta for use against
lepidoptera , eriophidmites , andWestern flower thrips ; it has approval in a number of countries for use on a variety of crops, including soybeans and maize.
Wikimedia Foundation. 2010.