- Lobenzarit
Drugbox
IUPAC_name = 2- [(2-Carboxyphenyl)amino] -4-chlorobenzoic acid
CAS_number = 63329-53-3
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 3946
DrugBank =
chemical_formula =
C=14 | H=10 | Cl=1 | N=1 | O=4
molecular_weight = 291.68 g/mol
smiles = C1=CC=C(C(=C1)C(=O)O)NC2=C(C=CC(=C2)Cl)C(=O)O
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = OralLobenzarit (INN) is a drug used in the treatment of arthritis. It is an immunomodulator.cite journal |author=Abe T |title= [Development and clinical use of chemical immunomodulators] |language=Japanese |journal=Nippon Rinsho |volume=39 |issue=4 |pages=1893–901 |year=1981 |month=April |pmid=6796722 |doi= |url=]
References
Wikimedia Foundation. 2010.