TP-13

drugbox
IUPAC_name = 7-Cyclobutyl-6-(2-ethyl-2H-1,2,4-triazol-3-ylmethoxy)-3-phenyl-1,2,4-triazolo [4,3-b] pyridazine


CAS_number =
ATC_prefix =
ATC_suffix =
PubChem =
DrugBank =
C=19|H=19|N=7|O=1
molecular_weight = 361.400 g/mol
smiles = C5CCC5c3cc2nnc(-c4ccccc4)n2nc3OCc1ncnn1C
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

TP-13 is an anxiolytic drug with a novel chemical structure, which is used in scientific research. It has similar effects to benzodiazepine drugs, but is structurally distinct and so is classed as a nonbenzodiazepine anxiolytic. It is a subtype-selective partial agonist at GABA_A receptors, binding selectively to GABA_A receptor complexes bearing α2 and α3 subunits. [McCabe C, Shaw D, Atack JR, Street LJ, Wafford KA, Dawson GR, Reynolds DS, Leslie JC. Subtype-selective GABAergic drugs facilitate extinction of mouse operant behaviour. "Neuropharmacology". 2004 Feb;46(2):171-8. PMID 14680756] It has modest anticonvulsant activity although less than that of diazepam, [Fradley RL, Guscott MR, Bull S, Hallett DJ, Goodacre SC, Wafford KA, Garrett EM, Newman RJ, O'Meara GF, Whiting PJ, Rosahl TW, Dawson GR, Reynolds DS, Atack JR. Differential contribution of GABA(A) receptor subtypes to the anticonvulsant efficacy of benzodiazepine site ligands. "Journal of Psychopharmacology". 2007 Jun;21(4):384-91. PMID 17092983] and its main effect is likely to be selective anxiolytic action, as seen with other related α2/3-preferring agonists such as L-838,417.

References