Sivelestat

Drugbox
IUPAC_name = 2-( [2-( [4-(2,2-dimethylpropanoyloxy)phenyl] sulfonylamino)benzoyl] amino)acetic acid

---

CAS_number = 127373-66-4
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 107706
DrugBank =
chemical_formula =
C=20 | H=22 | N=2 | O=7 | S=1
molecular_weight = 434.46 g/mol
smiles = CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)O
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = IV

Sivelestat (INN, research name ONO 5046, marketed as Elaspol) is an inhibitor of human neutrophil elastase.cite journal |author=Kawabata K, Suzuki M, Sugitani M, Imaki K, Toda M, Miyamoto T |title=ONO-5046, a novel inhibitor of human neutrophil elastase |journal=Biochem. Biophys. Res. Commun. |volume=177 |issue=2 |pages=814–20 |year=1991 |month=June |pmid=2049103 |doi= |url=http://linkinghub.elsevier.com/retrieve/pii/0006-291X(91)91862-7]

It is commonly used in the treatment of acute respiratory failure.cite journal |author=Imokawa S, Mori K, Harada M, "et al" |title= [Acute respiratory failure due to pneumocystis pneumonia successfully treated with combined use of sivelestat sodium hydrate] |language=Japanese |journal=Nihon Kokyuki Gakkai Zasshi |volume=46 |issue=6 |pages=461–5 |year=2008 |month=June |pmid=18592991 |doi= |url=]

References