Lurosetron

Lurosetron

Drugbox
IUPAC_name = 6-fluoro-5-methyl-2- [(5-methyl-1H-imidazol-4-yl)methyl] -3,4-dihydropyrido [4,3-b] indol-1-one


CAS_number = 143486-90-2
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 3037237
DrugBank =
chemical_formula =
C=17 | H=17 | F=1 | N=4 | O=1
molecular_weight = 312.341 g/mol
smiles = CC1=C(N=CN1)CN2CCC3=C(C2=O)C4=C(N3C)C(=CC=C4)F
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Lurosetron (INN) is a serotonin 5-HT3 receptor antagonist. [Prakash SP, Cable KM, Correa ID, Fellows L, Montgomery S, Newman JJ, Waterhouse L, Wells GN, Sutherland DR. Synthesis of isotopically labelled pyridoindolone 5-HT3 receptor antagonists. "Journal of Labelled Compounds and Radiopharmaceuticals". 1995; 36(10):993-1007.]

References


Wikimedia Foundation. 2010.

Игры ⚽ Нужно сделать НИР?

Share the article and excerpts

Direct link
Do a right-click on the link above
and select “Copy Link”