- U-90042
drugbox
IUPAC_name = 11-Chloro-5-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2,3-di hydrodiimidazo [1,5-a:1',2'-c] quinazoline
width = 140
CAS_number = 134516-99-7
ATC_prefix =
ATC_suffix =
PubChem = 9928470
DrugBank =
C=17|H=13|Cl=1|N=6|O=1
molecular_weight = 352.78 g/mol
smiles = C5CC5c4onc(n4)-c2ncn(c(cc3)c1cc3Cl)c2n6c1=NCC6
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =U-90042 is a
sedative andhypnotic drug used in scientific research. It has similar effects to sedative-hypnoticbenzodiazepine drugs, but is structurally distinct and so is classed as anonbenzodiazepine hypnotic.U-90042 is a GABAA agonist acting primarily at the α1, α3 and α6 subtypes, with a Ki of 7.8nM at α1, 9.5nM at α3 and 11.0nM at α6. It produces
sedation andataxia and prolongs sleeping time in mice, rats and monkeys, but does not produceamnesia and blocks the amnestic effect ofdiazepam , reflecting its different subtype affinity compared to benzodiazepine drugs. [Tang AH, Smith MW, Carter DB, Im WB, VonVoigtlander PF. U-90042, a sedative/hypnotic compound that interacts differentially with the GABAA receptor subtypes. "Journal of Pharmacology and Experimental Therapeutics". 1995 Nov;275(2):761-7. PMID 7473164]References
Wikimedia Foundation. 2010.