Catalpic acid

Chembox new
ImageFile = Catalpic acid.png ImageSize =
IUPACName = (9"E",11"E",13"Z")-octadeca-9,11,13-trienoic acid
OtherNames =
Section1 = Chembox Identifiers
CASNo = 4337-71-7
PubChem =
SMILES = O=C(O)CCCCCCC/C=CC=CC=C/CCCC
Section2 = Chembox Properties
Formula = C₁₈H₃₀O₂
MolarMass = 302.45 g/mol
Appearance = 278.43
Density =
MeltingPtC = 44
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

Catalpic acid is a conjugated polyunsaturated fatty acid. The melting point of this fatty acid is 32 °C. Catalpic acid occurs naturally in the seeds of "Catalpa ovata" and Southern Catalpa ("Catalpa bignonoides"). Seeds of "Catalpa" species contain about 40% catalpic acid. [Gunstone, F.D et al. (2007). The Lipid Handbook with CD-ROM, Boca Raton: CRC Press. ISBN 0-8493-9688-3]

References