Ablukast

Ablukast

Drugbox
IUPAC_name = 6-acetyl-7- [5-(4-acetyl-3-hydroxy-2-propylphenoxy)pentoxy] chroman-2-carboxylic acid



CAS_number = 96566-25-5
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 57109
DrugBank =
chemical_formula =
C=28 | H=34 | O=8
molecular_weight = 498.565 g/mol
smiles = CCCC1=C(C=CC(=C1O)C(=O)C)OCCCCCOC2=CC3=C(CCC(O3)C(=O)O)C=C2C(=O)C
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Ablukast (INN) is a Leukotriene antagonist which has applications in the treatment of inflammatory skin conditions. [Rosenbach T, Csatò M, Czarnetzki BM. Studies on the role of leukotrienes in murine allergic and irritant contact dermatitis. "British Journal of Dermatology". 1988 Jan;118(1):1-6. PMID 2829957]

References


Wikimedia Foundation. 2010.

Игры ⚽ Поможем написать реферат

Share the article and excerpts

Direct link
Do a right-click on the link above
and select “Copy Link”