Periciazine

Drugbox
IUPAC_name = 10- [3-(4-hydroxypiperidin-1-yl)propyl] phenothiazine-2-carbonitrile


CAS_number = 2622-26-6
CAS_supplemental =
ATC_prefix = N05
ATC_suffix = AC01
ATC_supplemental =
PubChem = 4747
DrugBank =
chemical_formula =
C=21 | H=23 | N=3 | O=1 | S=1
molecular_weight = 365.49 g/mol
smiles = C1CN(CCC1O)CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C#N
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK = POM
legal_US =
legal_status =
routes_of_administration = Oral

Periciazine (INN; also known as Pericyazine or Propericiazine) is a medication that belongs to the phenothiazine class of antipsychotics. It has also been studied in the treatment of opiate dependence.cite journal |author=Sivolap IuP, Savchenkov VA |title= [The use of neuroleptics in treating opiate dependence] |language=Russian |journal=Zh Nevrol Psikhiatr Im S S Korsakova |volume=99 |issue=6 |pages=29–34 |year=1999 |pmid=10441864 |doi= |url=]

Periciazine is not approved for sale in the United States or Canada. It is commonly sold in the United Kingdom under the tradename Neulactil.

References

External links

* [http://emc.medicines.org.uk/emc/assets/c/html/displaydoc.asp?documentid=15171 Neulactil - Summary of Product Characteristics] from the electronic Medicines Compendium