- Benexate
Drugbox
IUPAC_name = phenylmethyl 2- [4- [(diaminomethylideneamino)methyl] cyclohexanecarbonyl] oxybenzoate
CAS_number = 78718-52-2
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 2316
DrugBank =
chemical_formula =
C=23 | H=27 | N=3 | O=4
molecular_weight = 409.47 g/mol
smiles = C1CC(CCC1CN=C(N)N)C(=O)OC2=CC=CC=C2C(=O)OCC3=CC=CC=C3
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = OralBenexate (INN) is a drug used in the treatment of acid-related disorders.
Wikimedia Foundation. 2010.