Pranoprofen

Pranoprofen

Drugbox
IUPAC_name = 2-(5H-chromeno [2,3-b] pyridin-7-yl)propanoic acid


CAS_number = 52549-17-4
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 4888
DrugBank =
chemical_formula =
C=15 | H=13 | N=1 | O=3
molecular_weight = 255.26 g/mol
smiles = CC(C1=CC2=C(C=C1)OC3=C(C2)C=CC=N3)C(=O)O
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = Oral

Pranoprofen (INN) is a non-steroidal anti-inflammatory drug.


Wikimedia Foundation. 2010.

Игры ⚽ Нужен реферат?

Look at other dictionaries:

  • ATC code S01 — A section of the Anatomical Therapeutic Chemical Classification System.S Sensory organs01A Anti infectives01AA Antibiotics:S01AA01 Chloramphenicol:S01AA02 Chlortetracycline:S01AA03 Neomycin:S01AA04 Oxytetracycline:S01AA05 Tyrothricin:S01AA07… …   Wikipedia

Share the article and excerpts

Direct link
Do a right-click on the link above
and select “Copy Link”