Dimethyl pimelimidate dihydrochloride

Chembox new
Name = Dimethyl pimelimidate dihydrochloride
ImageFile = Dimethyl pimelimidate dihydrochloride.svg
ImageFile1 = Dimethyl-pimelimidate-3D-balls.png IUPACName = 1,7-dimethoxyheptane-1,7-diimine dihydrochloride
OtherNames = Pimelimidic acid dimethyl ester dihydrochloride, dimethyl heptane-1,7-diimidate dihydrochloride
Section1 = Chembox Identifiers
SMILES = COC(=N)CCCCCC(=N)OC.Cl.Cl
CASNo = 58537-94-3
PubChem = 11402688
Section2 = Chembox Properties
Formula = [CH₃OC(=NH)CH₂CH₂] ₂CH₂ · 2HCl
MolarMass = 259.17 g/mol
Appearance = white crystalline powder
Solubility = Slightly soluble
MeltingPt = 122 °C
Section4 = Chembox Thermochemistry
Section7 = Chembox Hazards
NFPA-H = 1
NFPA-F = 1
NFPA-R = 0
FlashPt = Not determined

Dimethyl pimelimidate dihydrochloride (IUPAC systematic name: 1,7-dimethoxyheptane-1,7-diimine dihydrochloride) (often abbreviated as DMP), is an organic chemical compound with two functional imine groups, which both bind to free amino groups at pH range 7.0-10.0 to form amidine bonds.

Uses

DMP is used mainly as bifunctional coupling reagent to link proteins. It is often used to prepare antibody affinity columns. The appropriate antibody is first incubated with Protein A or Protein G-agarose and allowed to bind. DMP is then added to couple the molecules together.

Health effects

Dimethyl pimelimidate (DMP) is irritating to the eyes, skin, mucous membranes and upper respiratory tract. It can exert harmful effects by inhalation, ingestion, or skin absorption.

References

* [http://www.mpbio.com/includes/msds/ansi/en/150945-en-ansi.pdf MSDS safety data] , also available in [http://www.mpbio.com/product_info.php?cPath=491_1_12&products_id=150945&processTab=technical other languages]
* [http://www.sigmaaldrich.com/catalog/search/ProductDetail/SIGMA/D8388?CHEMBUYERSGUIDE Sigma-Aldrich product detail]
* [http://www.technochemical.com/msds/EN0118.pdf MSDS datasheet]