- Isomescaline
Chembox new
ImageFile1 = Isomescaline.png
ImageSize1 = 200px
ImageFile2 =
ImageSize2 = 200px
IUPACName = 2-(2,3,4-Trimethoxyphenyl)-ethylamine
OtherNames = 2,3,4-Trimethoxyphenethylamine
2,3,4-Trimethoxy-1-ethaneamine
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = C1=CC(=C(C(=C1CCN)OC)OC)OC
Section2 = Chembox Properties
Formula = C11H17NO3
MolarMass = 211.260 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =Isomescaline, or 2,3,4-tri
methoxy phenethylamine , is a lesser-known psychedelic drug. It is anisomer ofmescaline , as well as an analog of TIM-2, TIM-3, and TIM-4. Isomescaline was first synthesized byAlexander Shulgin . In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the minimum dosage is listed as 400 mg, and the duration unknown. Despite its structural similarity to mescaline, isomescaline produces no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of isomescaline.See also
*
Phenethylamine
*Psychedelics, dissociatives and deliriants External links
* [http://www.erowid.org/library/books_online/pihkal/pihkal91.shtml Isomescaline entry in "PiHKAL"]
Wikimedia Foundation. 2010.