Hexachloroacetone

Chembox new
Name = Hexachloroacetone
ImageFile = Hexachloroacetone.png ImageName = Hexachloroacetone
IUPACName = 1,1,1,3,3,3-hexachloropropanone
OtherNames = perchloroacetone
HCA
Section1 = Chembox Identifiers
CASNo = 116-16-5
SMILES = ClC(Cl)(Cl)C(=O)C(Cl)(Cl)Cl
Section2 = Chembox Properties
Formula = C₃Cl₆O
MolarMass = 264.75 g/mol
Density = 1.444 g/cm³ [Handboek of Chemistry and Physics, 1st student edition, CRC Press (1987)]
MeltingPt = -2 °C
BoilingPt = 204 °C

Hexachloroacetone is an organic compound with the formula CCl₃-CO-CCl₃. It is also called hexachloropropanone or perchloroacetone. Numbers indicating the position of the chlorine-atoms might be added, but are not needed, as all possible positions are covered with chlorine. It is a colorless liquid that is slightly soluble in water.

The main use of hexachloroacetone is as a pesticide. For the use of hexachloroacetone in the preparation of a novel insect repellent see Perkow reaction.

References