Ufenamate

Ufenamate

Drugbox
IUPAC_name = butyl 2-( [3-(trifluoromethyl)phenyl] amino)benzoate



CAS_number = 67330-25-0
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 5632
DrugBank =
chemical_formula =
C=18 | H=18 | F=3 | N=1 | O=2
molecular_weight = 337.33 g/mol
smiles = CCCCOC(=O)C1=CC=CC=C1NC2=CC=CC(=C2)C(F)(F)F
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = Topical

Ufenamate (INN) is a topical analgesic.


Wikimedia Foundation. 2010.

Игры ⚽ Поможем сделать НИР

Look at other dictionaries:

  • ufenamate — noun A particular topical analgesic …   Wiktionary

Share the article and excerpts

Direct link
Do a right-click on the link above
and select “Copy Link”